| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM84852539-3 |
| Product Name | 1,2-Bis(perbromophenyl)ethane |
| CAS | 84852-53-9 |
| Structure |  |
| Synonyms | Decabromodiphenyl ethane |
| IUPAC Name | 1,2,3,4,5-Pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene |
| Molecular Weight | 971.2 |
| Molecular Formula | C14H4Br10 |
| Canonical SMILES | C(CC1=C(C(=C(C(=C1Br)Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
| InChI | InChI=1S/C14H4Br10/c15-5-3(6(16)10(20)13(23)9(5)19)1-2-4-7(17)11(21)14(24)12(22)8(4)18/h1-2H2 |
| InChIKey | BZQKBFHEWDPQHD-UHFFFAOYSA-N |
| Boiling Point | 676.2±50.0 °C |
| Melting Point | 345 °C |
| Purity | 96% |
| Density | 2.816±0.06 g/cm3 |
| Complexity | 352 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 971.20443 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Hydrogen Bond Acceptor Count | 0 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 961.2147 |
| Physical State | Solid |
| Rotatable Bond Count | 3 |
| Topological Polar Surface Area | 0 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
