| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM34052909-1 |
| Product Name | 1,3-Bis(4,5-dihydro-2-oxazolyl)benzene |
| CAS | 34052-90-9 |
| Structure |  |
| Synonyms | 1,3-Bis(4,5-dihydrooxazol-2-yl)benzene |
| IUPAC Name | 2-[3-(4,5-Dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole |
| Molecular Weight | 216.24 |
| Molecular Formula | C12H12N2O2 |
| InChI | InChI=1S/C12H12N2O2/c1-2-9(11-13-4-6-15-11)8-10(3-1)12-14-5-7-16-12/h1-3,8H,4-7H2 |
| InChIKey | HMOZDINWBHMBSQ-UHFFFAOYSA-N |
| Boiling Point | 403.5±28.0 °C |
| Melting Point | 143-146 °C |
| Flash Point | 208 °C |
| Purity | 99%+ |
| Complexity | 295 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 216.08987763 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 216.08987763 |
| Physical State | White powder |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 43.2 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
