| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM253585830 |
| Product Name | 1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime) |
| CAS | 253585-83-0 |
| Structure |  |
| Synonyms | 1,2-Octanedione, 1-(4-(phenylthio)phenyl)- |
| IUPAC Name | [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] benzoate |
| Molecular Weight | 445.57 |
| Molecular Formula | C27H27NO3S |
| Canonical SMILES | CCCCCCC(=NOC(=O)C1=CC=CC=C1)C(=O)C2=CC=C(C=C2)SC3=CC=CC=C3 |
| InChIKey | LOCXTTRLSIDGPS-AZPGRJICSA-N |
| Boiling Point | 594.723ºC at 760 mmHg |
| Melting Point | 40-45 °C |
| Flash Point | 313.478ºC |
| Purity | 99% |
| Density | 1.112g/cm³ |
| Exact Mass | 445.17100 |
| Physical State | Solid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
