| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM94576688 |
| Product Name | 1-(Biphenyl-4-yl)-2-methyl-2-morpholinopropan-1-one |
| CAS | 94576-68-8 |
| Synonyms | Irgacure 307 |
| IUPAC Name | 2-methyl-2-morpholin-4-yl-1-(4-phenylphenyl)propan-1-one |
| Molecular Weight | 309.2 |
| Molecular Formula | C20H23NO2 |
| Canonical SMILES | CC(C)(C(=O)C1=CC=C(C=C1)C2=CC=CC=C2)N3CCOCC3 |
| InChI | InChI=1S/C20H23NO2/c1-20(2,21-12-14-23-15-13-21)19(22)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11H,12-15H2,1-2H3 |
| InChIKey | FSFHRBPNIADRGI-UHFFFAOYSA-N |
| Melting Point | 120-125 °C |
| Purity | 99% |
| Complexity | 386 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 309.172879g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Monoisotopic Mass | 309.172879g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 4 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]-](https://resource.alfa-chemistry.com/structure/119344-86-4.gif)
![Poly(oxy-1,2-ethanediyl),α-[(9-oxo-9H-thioxanthen-4-yl)carbonyl]-ω-[[(9-oxo-9H-thioxanthen-4-yl)carbonyl]oxy]-](/PolymerStabilizer/images/structure-default.jpg)