| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM82799448-3 |
| Product Name | 2,4-Diethyl-9H-thioxanthen-9-one |
| CAS | 82799-44-8 |
| Structure |  |
| Synonyms | Diethylthioxanthenone |
| IUPAC Name | 2,4-diethylthioxanthen-9-one |
| Molecular Weight | 268.37 |
| Molecular Formula | C17H16OS |
| Canonical SMILES | CCC1=CC(=C2C(=C1)C(=O)C3=CC=CC=C3S2)CC |
| InChI | InChI=1S/C17H16OS/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)19-17/h5-10H,3-4H2,1-2H3 |
| InChIKey | BTJPUDCSZVCXFQ-UHFFFAOYSA-N |
| Boiling Point | 427.9 ± 45.0 °C |
| Melting Point | 71 - 75 °C |
| Purity | 95%+ |
| Density | 1.178 ± 0.06 g/ml |
| Appearance | Light yellow liquid |
| Application | Photoinitiator |
| Storage | 2 - 8 °C |
| Exact Mass | 268.09200 |
| Physical State | Solid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime)](https://resource.alfa-chemistry.com/structure/253585-83-0.gif)
