| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM84515-3 |
| Product Name | 2-Ethylanthraquinone |
| CAS | 84-51-5 |
| Structure |  |
| Synonyms | USAFso-1 |
| Description | DryPowder; PelletsLargeCrystals |
| IUPAC Name | 2-ethylanthracene-9,10-dione |
| Molecular Weight | 236.27 |
| Molecular Formula | C16H12O2 |
| Canonical SMILES | CCC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
| InChIKey | SJEBAWHUJDUKQK-UHFFFAOYSA-N |
| Boiling Point | 180-190 °C |
| Melting Point | ≥107.3 °C |
| Flash Point | >210 °C |
| Purity | 95%+ |
| Density | 1.27 g/ml |
| Appearance | Light yellow flake |
| Storage | Store below +30 °C. |
| Complexity | 360 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 236.08373g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Monoisotopic Mass | 236.08373g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 1 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
