| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM5495841-1 |
| Product Name | 2-Isopropylthioxanthone |
| CAS | 5495-84-1 |
| Structure |  |
| Synonyms | 2-Isopropylthioxanthen-9-one |
| IUPAC Name | 2-propan-2-ylthioxanthen-9-one |
| Molecular Weight | 254.35 |
| Molecular Formula | C16H14OS |
| Canonical SMILES | CC(C)C1=CC2=C(C=C1)SC3=CC=CC=C3C2=O |
| InChI | InChI=1S/C16H14OS/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15/h3-10H,1-2H3 |
| InChIKey | KTALPKYXQZGAEG-UHFFFAOYSA-N |
| Boiling Point | 398.9 ± 32.0 °C |
| Melting Point | 72 - 76 °C |
| Flash Point | 217ºC |
| Purity | 95%+ |
| Density | 1.199 ± 0.06 g/ml |
| Appearance | Light yellow liquid |
| Storage | Room temperature |
| Exact Mass | 254.07700 |
| Physical State | Solid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime)](https://resource.alfa-chemistry.com/structure/253585-83-0.gif)
