| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM48145046-5 |
| Product Name | 2-Phenoxyethyl acrylate |
| CAS | 48145-04-6 |
| Structure |  |
| Synonyms | 2-Phenoxyethyl prop-2-enoate |
| IUPAC Name | Ethylene glycol phenyl ether acrylate |
| Molecular Weight | 192.21 |
| Molecular Formula | C11H12O3 |
| InChI | InChI=1S/C11H12O3/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10/h2-7H,1,8-9H2 |
| InChIKey | RZVINYQDSSQUKO-UHFFFAOYSA-N |
| Boiling Point | 84 °C |
| Flash Point | >230 °F |
| Purity | 92% |
| Density | 1.104g/mL at 25°C(lit.) |
| Appearance | Liquid |
| Complexity | 183 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 192.078644241 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 3 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 192.078644241 |
| Physical State | Yellow to brown liquid |
| Rotatable Bond Count | 6 |
| Topological Polar Surface Area | 35.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Viscosity | 12 cp (25°C) |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
