| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM90937-2 |
| Product Name | 4,4'-Bis(diethylamino)benzophenone |
| CAS | 90-93-7 |
| Structure |  |
| Synonyms | 4,4'-Carbonylbis(N,N-diethylaniline) |
| Description | OtherSolid |
| IUPAC Name | Bis[4-(diethylamino)phenyl]methanone |
| Molecular Weight | 324.46 |
| Molecular Formula | C21H28N2O |
| Canonical SMILES | CCN(CC)C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N(CC)CC |
| InChI | InChI=1S/C21H28N2O/c1-5-22(6-2)19-13-9-17(10-14-19)21(24)18-11-15-20(16-12-18)23(7-3)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | VYHBFRJRBHMIQZ-UHFFFAOYSA-N |
| Boiling Point | 475.7 ± 30.0 °C |
| Melting Point | 90 - 94 °C |
| Flash Point | 151 °C |
| Purity | 95%+ |
| Density | 1.048 ± 0.06 g/ml |
| Appearance | Light yellow powder |
| Application | This product is suitable for scientific research. |
| Complexity | 326 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 324.220164g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Monoisotopic Mass | 324.220164g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 8 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
