| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM13595250-2 |
| Product Name | 4,4'-Dihydroxytetraphenylmethane |
| CAS | 13595-25-0 |
| Structure |  |
| Synonyms | Bis(4-hydroxyphenyl)diphenylmethane |
| IUPAC Name | 4-[(4-Hydroxyphenyl)-diphenylmethyl]phenol |
| Molecular Weight | 352.4 |
| Molecular Formula | C25H20O2 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
| InChI | InChI=1S/C25H20O2/c26-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19,20-9-5-2-6-10-20)22-13-17-24(27)18-14-22/h1-18,26-27H |
| InChIKey | BATCUENAARTUKW-UHFFFAOYSA-N |
| Boiling Point | 495.9±35.0 °C |
| Melting Point | 135-139 °C |
| Purity | 99% |
| Density | 1.107±0.06 g/cm3 |
| Complexity | 391 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 352.146329876 |
| Formal Charge | 0 |
| Heavy Atom Count | 27 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 352.146329876 |
| Physical State | Solid |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 40.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
