| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM13680358-2 |
| Product Name | 4,4'-Methylenebis(2,6-diethylaniline) |
| CAS | 13680-35-8 |
| Structure |  |
| Synonyms | 4,4'-Diamino-3,3',5,5'-tetraethyldiphenylmethane |
| IUPAC Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline |
| Molecular Weight | 310.48 |
| Molecular Formula | CH2[C6H2(C2H5)2NH2]2 |
| Canonical SMILES | CCc1cc(Cc2cc(CC)c(N)c(CC)c2)cc(CC)c1N |
| InChI | 1S/C21H30N2/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15/h10-13H,5-9,22-23H2,1-4H3 |
| InChIKey | NWIVYGKSHSJHEF-UHFFFAOYSA-N |
| Boiling Point | 205 °C |
| Melting Point | 88-90 °C (lit.) |
| Purity | 98% |
| Application | This product is suitable for scientific research. |
| Complexity | 283 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 310.240899g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Monoisotopic Mass | 310.240899g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 6 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
