| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM19900722-1 |
| Product Name | 4,4'-Methylenebis(2-ethyl-6-methylaniline) |
| CAS | 19900-72-2 |
| Structure |  |
| Synonyms | 4,4'-methylenebis (2-methyl-6-ethylaniline) |
| IUPAC Name | 4-[(4-amino-3-ethyl-5-methylphenyl)methyl]-2-ethyl-6-methylaniline |
| Molecular Weight | 282.42 |
| Molecular Formula | C19H26N2 |
| Canonical SMILES | CCC1=C(C(=CC(=C1)CC2=CC(=C(C(=C2)C)N)CC)C)N |
| InChI | InChI=1S/C19H26N2/c1-5-16-10-14(7-12(3)18(16)20)9-15-8-13(4)19(21)17(6-2)11-15/h7-8,10-11H,5-6,9,20-21H2,1-4H3 |
| InChIKey | QJENIOQDYXRGLF-UHFFFAOYSA-N |
| Boiling Point | 443.1±40.0 °C |
| Melting Point | 85 °C |
| Purity | 98% |
| Complexity | 287 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 282.209599g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Monoisotopic Mass | 282.209599g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 4 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
