| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM5973717-1 |
| Product Name | 4-Formyl-o-xylene |
| CAS | 5973-71-7 |
| Structure |  |
| Synonyms | O-xylene-4-carboxaldehyde |
| IUPAC Name | 3,4-Dimethylbenzaldehyde |
| Molecular Weight | 134.17 |
| Molecular Formula | C9H10O |
| InChI | InChI=1S/C9H10O/c1-7-3-4-9(6-10)5-8(7)2/h3-6H,1-2H3 |
| InChIKey | POQJHLBMLVTHAU-UHFFFAOYSA-N |
| Boiling Point | 226 °C |
| Melting Point | 225-226 °C |
| Flash Point | 225 °F |
| Complexity | 120 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 134.073164938 |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Hydrogen Bond Acceptor Count | 1 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 134.073164938 |
| Physical State | Clear colorless to yellow liquid |
| Rotatable Bond Count | 1 |
| Topological Polar Surface Area | 17.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate]](https://resource.alfa-chemistry.com/structure/151841-65-5.gif)
