| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2896700-3 |
| Product Name | 4-Oxo-2,2,6,6-tetramethylpiperidinooxy |
| CAS | 2896-70-0 |
| Structure |  |
| Synonyms | 4-Oxo-tempo |
| Molecular Weight | 170.23 |
| Molecular Formula | C9H16NO2 |
| Canonical SMILES | CC1(CC(=O)CC(N1[O])(C)C)C |
| InChI | InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3 |
| InChIKey | WSGDRFHJFJRSFY-UHFFFAOYSA-N |
| Boiling Point | 299.88 °C |
| Melting Point | 33-38 °C |
| Complexity | 189 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 170.118103753 |
| Formal Charge | 0 |
| Heavy Atom Count | 12 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 170.118103753 |
| Physical State | Orange needles, crystals or crystalline powder |
| Rotatable Bond Count | 0 |
| Topological Polar Surface Area | 21.3 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
