| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM119619-2 |
| Product Name | Benzophenone |
| CAS | 119-61-9 |
| Structure |  |
| Synonyms | Dipheny ketone |
| Description | Benzophenone is the organic compound with the formula (C6H5)2CO, generally abbreviated Ph2CO. Benzophenone is a widely used building block in organic chemistry, being the parent diarylketone. |
| IUPAC Name | Diphenylmethanone |
| Molecular Weight | 182.22 |
| Molecular Formula | C13H10O |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Boiling Point | 305 °C |
| Melting Point | 47-51 °C |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 1.11 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water and glycerol; slightly soluble in propylene glycol; soluble in oils |
| Appearance | Orange crystals |
| Application | Benzophenone is mainly used as a photoinitiator molecule in a variety of 3D printing s. It has a high quantum yield that makes it useful in the development of UV curable photopolymers. |
| Autoignition Temperature | 650 °C |
| Complexity | 165 |
| Covalently-Bonded Unit Count | 1 |
| Decomposition | When heated to decomp it emits acrid and irritating fumes.;>320 °C |
| Defined Atom Stereocenter Count | 0 |
| Exact Mass | 182.073164938 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 1 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 182.073164938 |
| Physical State | Crystalline powder |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 17.1 Ų |
| Vapor Pressure | 1 mm Hg ( 108 °C) |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime)](https://resource.alfa-chemistry.com/structure/253585-83-0.gif)
