| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2128930-1 |
| Product Name | 4-Benzoylbiphenyl |
| CAS | 2128-93-0 |
| Structure |  |
| Synonyms | 4-Diphenylphenyl ketone |
| Description | DryPowder |
| IUPAC Name | Phenyl-(4-phenylphenyl)methanone |
| Molecular Weight | 258.31 |
| Molecular Formula | C19H14O |
| InChI | InChI=1S/C19H14O/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H |
| InChIKey | LYXOWKPVTCPORE-UHFFFAOYSA-N |
| Boiling Point | 419-420 °C |
| Melting Point | 99 - 103 °C |
| Purity | 95%+ |
| Density | 1.0651 g/ml |
| Appearance | White crystal powder |
| Storage | Room temperature |
| Complexity | 302 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 258.104465g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Monoisotopic Mass | 258.104465g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 3 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime)](https://resource.alfa-chemistry.com/structure/253585-83-0.gif)
