| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM106246337 |
| Product Name | Bis(4-amino-2-chloro-3,5-diethylphenyl)methane |
| CAS | 106246-33-7 |
| Structure |  |
| Synonyms | Benzenamine, 4,4-methylenebis3-chloro-2,6-diethyl- |
| Description | DryPowder; PelletsLargeCrystals |
| IUPAC Name | 4-[(4-amino-2-chloro-3,5-diethylphenyl)methyl]-3-chloro-2,6-diethylaniline |
| Molecular Weight | 379.37 |
| Molecular Formula | C21H28Cl2N2 |
| Canonical SMILES | CCC1=CC(=C(C(=C1N)CC)Cl)CC2=C(C(=C(C(=C2)CC)N)CC)Cl |
| InChI | InChI=1S/C21H28Cl2N2/c1-5-12-9-14(18(22)16(7-3)20(12)24)11-15-10-13(6-2)21(25)17(8-4)19(15)23/h9-10H,5-8,11,24-25H2,1-4H3 |
| InChIKey | VIOMIGLBMQVNLY-UHFFFAOYSA-N |
| Boiling Point | 506.4±45.0 °C |
| Melting Point | 88 °C |
| Purity | 98% |
| Complexity | 369 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 378.162954g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Monoisotopic Mass | 378.162954g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 6 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
