| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM15317789 |
| Product Name | Bis(diisobutyldithiocarbamato)nickel |
| CAS | 15317-78-9 |
| Structure |  |
| Synonyms | Nickel diisobutyldithiocarbamate |
| IUPAC Name | N,N-Bis(2-methylpropyl)carbamodithioate;nickel(2+) |
| Molecular Weight | 467.5 |
| Molecular Formula | C18H36N2NiS4 |
| Canonical SMILES | CC(C)CN(CC(C)C)C(=S)[S-].CC(C)CN(CC(C)C)C(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C9H19NS2.Ni/c2*1-7(2)5-10(9(11)12)6-8(3)4;/h2*7-8H,5-6H2,1-4H3,(H,11,12);/q;+2/p-2 |
| InChIKey | YCBUXHNUQAZVSS-UHFFFAOYSA-L |
| Boiling Point | 441.63 °C |
| Density | 1.27 g/cm3 |
| Complexity | 128 |
| Covalently-Bonded Unit Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 466.111476 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 466.111476 |
| Physical State | Green powder |
| Rotatable Bond Count | 8 |
| Topological Polar Surface Area | 72.7 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
