| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM5945335-1 |
| Product Name | Bisphenol A bis(diphenyl phosphate) |
| CAS | 5945-33-5 |
| Structure |  |
| Synonyms | [4-[2-(4-diphenoxyphosphoryloxyphenyl)propan-2-yl]phenyl] diphenyl phosphate; |
| Description | Bisphenol A Bis(diphenyl phosphate) is a flame retardant. Bisphenol A Bis(diphenyl phosphate) is used in electrical wire covering and other flame resistant materials. |
| IUPAC Name | [4-[2-(4-Diphenoxyphosphoryloxyphenyl)propan-2-yl]phenyl] diphenyl phosphate |
| Molecular Weight | 692.6 |
| Molecular Formula | C39H34O8P2 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3)C4=CC=C(C=C4)OP(=O)(OC5=CC=CC=C5)OC6=CC=CC=C6 |
| InChI | InChI=1S/C39H34O8P2/c1-39(2,31-23-27-37(28-24-31)46-48(40,42-33-15-7-3-8-16-33)43-34-17-9-4-10-18-34)32-25-29-38(30-26-32)47-49(41,44-35-19-11-5-12-20-35)45-36-21-13-6-14-22-36/h3-30H,1-2H3 |
| InChIKey | BQPNUOYXSVUVMY-UHFFFAOYSA-N |
| Boiling Point | 679.6±48.0 °C |
| Flash Point | 377.204ºC |
| Purity | Technical grade |
| Density | 1.284 g/cm³ |
| Complexity | 931 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 692.17289203 |
| Formal Charge | 0 |
| Heavy Atom Count | 49 |
| Hydrogen Bond Acceptor Count | 8 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 692.17289203 |
| Physical State | Liquid |
| Rotatable Bond Count | 14 |
| Topological Polar Surface Area | 89.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![(6H-Dibenz[c,e][1,2]oxaphosphorin-6-ylmethyl)-p-oxide-butanedioic acid](https://resource.alfa-chemistry.com/structure/63562-33-4.gif)