| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM13927714-2 |
| Product Name | Copper dibutyldithiocarbamate |
| CAS | 13927-71-4 |
| Structure |  |
| Synonyms | Bis(dibutyldithiocarbamato-S,S')copper |
| IUPAC Name | Copper;N,N-dibutylcarbamodithioate |
| Molecular Weight | 472.3 |
| Molecular Formula | C18H36CuN2S4 |
| Canonical SMILES | CCCCN(CCCC)C(=S)[S-].CCCCN(CCCC)C(=S)[S-].[Cu+2] |
| InChI | InChI=1S/2C9H19NS2.Cu/c2*1-3-5-7-10(9(11)12)8-6-4-2;/h2*3-8H2,1-2H3,(H,11,12);/q;+2/p-2 |
| InChIKey | IXPUJMULXNNEHS-UHFFFAOYSA-L |
| Boiling Point | 484.97 °C |
| Melting Point | 60-61 °C |
| Complexity | 112 |
| Covalently-Bonded Unit Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 471.105731 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 471.105731 |
| Physical State | Black powder |
| Rotatable Bond Count | 12 |
| Topological Polar Surface Area | 72.7 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
