| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM6440580-1 |
| Product Name | Dimethyloldimethyl hydantoin |
| CAS | 6440-58-0 |
| Structure |  |
| Synonyms | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione; DMDMH |
| Description | Dimethyloldimethyl hydantoin is used as preservative in a broad number of household and industrial cleaners to prevent spoilage from microorganisms, and it is a concentrated industrial preservative that can be used in a broad number of H, I & I formulations to prevent product spoilage. |
| IUPAC Name | 1,3-Bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
| Molecular Weight | 188.18 |
| Molecular Formula | C7H12N2O4 |
| Canonical SMILES | CC1(C(=O)N(C(=O)N1CO)CO)C |
| InChI | InChI=1S/C7H12N2O4/c1-7(2)5(12)8(3-10)6(13)9(7)4-11/h10-11H,3-4H2,1-2H3 |
| InChIKey | WSDISUOETYTPRL-UHFFFAOYSA-N |
| Boiling Point | 303.7±52.0 °C |
| Melting Point | 1.00-2.5 °C |
| Density | 1.349±0.06 g/cm3 |
| Solubility | soluble in water |
| Appearance | Colorless to light yellow clear liquid |
| Complexity | 251 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 188.07970687 |
| Formal Charge | 0 |
| Heavy Atom Count | 13 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 188.07970687 |
| pH | 6.0-8.0 |
| Physical State | White powder |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 81.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
