| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM3071703-3 |
| Product Name | DTTCI |
| CAS | 3071-70-3 |
| Structure |  |
| Synonyms | 3,3'-Diethylthiatricarbocyanineiodide |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazole;iodide |
| Molecular Weight | 544.52 |
| Molecular Formula | C25H25N2S2I |
| Canonical SMILES | CCN\1C2=CC=CC=C2S/C1=C\C=C\C=C\C=C\C3=[N+](C4=CC=CC=C4S3)CC.[I-] |
| InChI | InChI=1S/C25H25N2S2.HI/c1-3-26-20-14-10-12-16-22(20)28-24(26)18-8-6-5-7-9-19-25-27(4-2)21-15-11-13-17-23(21)29-25;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OYVFJKVYVDYPFV-UHFFFAOYSA-M |
| Melting Point | 211 °C |
| Purity | 98%+ |
| Appearance | Green powder |
| Storage | Stored at -20 °C |
| Physical State | Solid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![2-[2-[3-[2-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-2-[(1-phenyl-1H-tetrazol-5-yl)thio]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-3H-indolium chloride](https://resource.alfa-chemistry.com/structure/440102-72-7.gif)