| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM10287533-2 |
| Product Name | Ethyl 4-(dimethylamino)benzoate |
| CAS | 10287-53-3 |
| Structure |  |
| Synonyms | Parbenate |
| Description | DryPowder; PelletsLargeCrystals |
| IUPAC Name | ethyl 4-(dimethylamino)benzoate |
| Molecular Weight | 193.24 |
| Molecular Formula | C11H15NO2 |
| InChI | InChI=1S/C11H15NO2/c1-4-14-11(13)9-5-7-10(8-6-9)12(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | FZUGPQWGEGAKET-UHFFFAOYSA-N |
| Melting Point | 63-66 °C |
| Purity | 99% |
| Complexity | 184 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 193.110279g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Monoisotopic Mass | 193.110279g/mol |
| Physical State | Solid |
| Rotatable Bond Count | 4 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
