| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM15206550-2 |
| Product Name | Methyl benzoylformate |
| CAS | 15206-55-0 |
| Structure |  |
| Synonyms | PI-MBF |
| Description | Liquid |
| IUPAC Name | Methyl2-oxo-2-phenylacetate |
| Molecular Weight | 164.16 |
| Molecular Formula | C9H8O3 |
| InChI | InChI=1S/C9H8O3/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | YLHXLHGIAMFFBU-UHFFFAOYSA-N |
| Boiling Point | 246 - 248 °C |
| Melting Point | 16 °C |
| Purity | 95%+ |
| Density | 1.155 g/ml |
| Appearance | Light yellow liquid |
| Application | This product is suitable for scientific research. |
| Storage | Store below +30 °C. |
| Complexity | 180 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 164.047344g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 12 |
| Monoisotopic Mass | 164.047344g/mol |
| Physical State | Liquid |
| Rotatable Bond Count | 3 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-[4-(Phenylthio)phenyl]-1,2-octanedione 2-(o-benzoyloxime)](https://resource.alfa-chemistry.com/structure/253585-83-0.gif)
