| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM134849-1 |
| Product Name | 4-Methylbenzophenone |
| CAS | 134-84-9 |
| Structure |  |
| Synonyms | P-METHYLBENZOPHENONE;usafdo-54;4-Benzoyltoluene;4-MeC6H4COPh;Methanone, (4-methylphenyl)phenyl- |
| Description | Benzophenone estrogenicity toxicity structure activity. |
| IUPAC Name | (4-methylphenyl)-phenylmethanone |
| Molecular Weight | 196.24 |
| Molecular Formula | C14H12O |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C14H12O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | WXPWZZHELZEVPO-UHFFFAOYSA-N |
| Boiling Point | 326 °C |
| Melting Point | 53-57ºC |
| Flash Point | 143ºC |
| Purity | 95%+ |
| Density | 1.067 g/cm³ |
| Appearance | White to slightly yellow powder |
| Application | This product is suitable for scientific research. |
| Storage | Room temperature |
| Physical State | Solid |
| Vapor Pressure | 0.000413mmHg at 25°C |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]-](https://resource.alfa-chemistry.com/structure/119344-86-4.gif)
![Poly(oxy-1,2-ethanediyl),α-[(9-oxo-9H-thioxanthen-4-yl)carbonyl]-ω-[[(9-oxo-9H-thioxanthen-4-yl)carbonyl]oxy]-](/PolymerStabilizer/images/structure-default.jpg)
