| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM15521650 |
| Product Name | Nickel bis(dimethyldithiocarbamate) |
| CAS | 15521-65-0 |
| Structure |  |
| Synonyms | Methyl niclate |
| IUPAC Name | N,N-Dimethylcarbamodithioate;nickel(2+) |
| Molecular Weight | 299.1 |
| Molecular Formula | C6H12N2NiS4 |
| Canonical SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C3H7NS2.Ni/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;+2/p-2 |
| InChIKey | BLCKKNLGFULNRC-UHFFFAOYSA-L |
| Boiling Point | 488.62 °C |
| Melting Point | >290 °C |
| Density | 1.77 g/cm3 |
| Complexity | 54.3 |
| Covalently-Bonded Unit Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 297.923675 |
| Formal Charge | 0 |
| Heavy Atom Count | 13 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 297.923675 |
| Physical State | Green powder |
| Rotatable Bond Count | 0 |
| Topological Polar Surface Area | 72.7 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
