| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2081085-2 |
| Product Name | 1,1-Bis(4-hydroxyphenyl)ethane |
| CAS | 2081-08-5 |
| Structure |  |
| Synonyms | Bisphenol E |
| IUPAC Name | 4-[1-(4-Hydroxyphenyl)ethyl]phenol |
| Molecular Weight | 214.26 |
| Molecular Formula | C14H14O2 |
| Canonical SMILES | CC(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C14H14O2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10,15-16H,1H3 |
| InChIKey | HCNHNBLSNVSJTJ-UHFFFAOYSA-N |
| Boiling Point | 215 °C |
| Melting Point | 123-127 °C |
| Purity | 98% |
| Density | 1.171±0.06 g/cm3 |
| Complexity | 179 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 214.099379685 |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 214.099379685 |
| Physical State | Solid |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 40.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
