| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM68548083-4 |
| Product Name | 1,2,2,6,6-Pentamethyl-4-piperidyl methacrylate |
| CAS | 68548-08-3 |
| Structure |  |
| Synonyms | 2-Propenoic acid, 2-methyl-, 1,2,2,6,6-pentamethyl-4-piperidinyl ester |
| IUPAC Name | (1,2,2,6,6-Pentamethylpiperidin-4-yl) 2-methylprop-2-enoate |
| Molecular Weight | 239.35 |
| Molecular Formula | C14H25NO2 |
| Canonical SMILES | CC(=C)C(=O)OC1CC(N(C(C1)(C)C)C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-10(2)12(16)17-11-8-13(3,4)15(7)14(5,6)9-11/h11H,1,8-9H2,2-7H3 |
| InChIKey | NWPIOULNZLJZHU-UHFFFAOYSA-N |
| Flash Point | 112 °C |
| Purity | 97%+ |
| Density | 0.97 g/mL |
| Complexity | 313 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 239.18852904 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Hydrogen Bond Acceptor Count | 3 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 239.18852904 |
| Physical State | Liquid |
| Rotatable Bond Count | 3 |
| Topological Polar Surface Area | 29.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![2-[2-[3-[2-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-2-[(1-phenyl-1H-tetrazol-5-yl)thio]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-3H-indolium chloride](https://resource.alfa-chemistry.com/structure/440102-72-7.gif)
![4-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-1,3-benzenediol](https://resource.alfa-chemistry.com/structure/1668-53-7.gif)
![3-Butyl-2-[3-(3-butyl-1,3-dihydro-1,1-dimethyl-2H-benz[e]indol-2-ylidene)-1-propen-1-yl]-1,1-dimethyl-1H-benz[e]indolium iodide](https://resource.alfa-chemistry.com/structure/886046-46-4.gif)