| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM24650428-3 |
| Product Name | 2,2-Dimethoxy-2-phenylacetophenone |
| CAS | 24650-42-8 |
| Structure |  |
| Synonyms | α,α-Dimethoxy-α-phenylacetophenone, Benzil α,α-dimethyl acetal |
| IUPAC Name | 2,2-dimethoxy-1,2-diphenylethanone |
| Molecular Weight | 256.30 |
| Molecular Formula | C6H5COC(OCH3)2C6H5 |
| Canonical SMILES | COC(OC)(C(=O)c1ccccc1)c2ccccc2 |
| InChI | 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 |
| InChIKey | KWVGIHKZDCUPEU-UHFFFAOYSA-N |
| Boiling Point | 300ºC |
| Melting Point | 67-70 °C (lit.) |
| Flash Point | >190 °C |
| Purity | 99% |
| Density | 1.122g/cm³ |
| Appearance | colourless crystalline |
| Application | Photocuring agent |
| Exact Mass | 256.11000 |
| Physical State | Solid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]-](https://resource.alfa-chemistry.com/structure/119344-86-4.gif)