| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM3135191-1 |
| Product Name | 2,4,6-Tri(4'-butoxy-2'-hydroxyphenyl)-triazine |
| CAS | 3135-19-1 |
| Structure |  |
| Synonyms | 2,4,6-Tris-(2'-Hydroxy-4'-butoxyphenyl)-1,3,5-triazine |
| IUPAC Name | 2-[4,6-Bis(4-butoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-5-butoxyphenol |
| Molecular Weight | 573.7 |
| Molecular Formula | C33H39N3O6 |
| Canonical SMILES | CCCCOC1=CC(=C(C=C1)C2=NC(=NC(=N2)C3=C(C=C(C=C3)OCCCC)O)C4=C(C=C(C=C4)OCCCC)O)O |
| InChI | InChI=1S/C33H39N3O6/c1-4-7-16-40-22-10-13-25(28(37)19-22)31-34-32(26-14-11-23(20-29(26)38)41-17-8-5-2)36-33(35-31)27-15-12-24(21-30(27)39)42-18-9-6-3/h10-15,19-21,37-39H,4-9,16-18H2,1-3H3 |
| InChIKey | BOYPAYBWCQZOGC-UHFFFAOYSA-N |
| Boiling Point | 786.0±70.0 °C |
| Melting Point | 154 °C |
| Purity | 98%+ |
| Complexity | 642 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 573.28388597 |
| Formal Charge | 0 |
| Heavy Atom Count | 42 |
| Hydrogen Bond Acceptor Count | 9 |
| Hydrogen Bond Donor Count | 3 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 573.28388597 |
| Physical State | Solid |
| Rotatable Bond Count | 15 |
| Topological Polar Surface Area | 127 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate](https://resource.alfa-chemistry.com/structure/96478-09-0.gif)
![Butanenitrile, 4,4',4'',4''',4'''',4''''',4'''''',4'''''''-[1,4-phenylenebis[nitrilobis(4,1-phenylenenitrilo)]]octakis-, radical ion(1+), (OC-6-11)-hexafluoroantimonate](/PolymerStabilizer/images/structure-default.jpg)
