| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM7128645-3 |
| Product Name | 2,5-Bis(5-tert-butyl-benzoxazol-2-yl)thiophene |
| CAS | 7128-64-5 |
| Structure |  |
| Synonyms | BBOT |
| Description | DryPowder; OtherSolid |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| Molecular Weight | 430.56 |
| Molecular Formula | C26H26N2O2S |
| Canonical SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| InChI | InChI=1S/C26H26N2O2S/c1-25(2,3)15-7-9-19-17(13-15)27-23(29-19)21-11-12-22(31-21)24-28-18-14-16(26(4,5)6)8-10-20(18)30-24/h7-14H,1-6H3 |
| InChIKey | AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| Melting Point | 201-205 °C |
| Purity | 99% |
| Complexity | 590 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 430.171499g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 31 |
| Monoisotopic Mass | 430.171499g/mol |
| Physical State | Powder |
| Rotatable Bond Count | 4 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![Disodium 4,4'-bis[(4-anilino-6-methoxy-1,3,5-triazin-2-yl)amino]stilbene-2,2'-disulphonate](https://resource.alfa-chemistry.com/structure/3426-43-5.gif)
