| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM489010-1 |
| Product Name | 2,6-DI-tert-butyl-4-methoxyphenol |
| CAS | 489-01-0 |
| Structure |  |
| Synonyms | 3,5-Di-tert-butyl-4-hydroxyanisole |
| IUPAC Name | 2,6-Ditert-butyl-4-methoxyphenol |
| Molecular Weight | 236.35 |
| Molecular Formula | C15H24O2 |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)OC |
| InChI | InChI=1S/C15H24O2/c1-14(2,3)11-8-10(17-7)9-12(13(11)16)15(4,5)6/h8-9,16H,1-7H3 |
| InChIKey | SLUKQUGVTITNSY-UHFFFAOYSA-N |
| Boiling Point | 135-140 °C |
| Melting Point | 102-106 °C |
| Flash Point | 135-140 °C |
| Purity | 98%+ |
| Density | 0.9845 g/mL |
| Appearance | White to beige crystalline powder |
| Complexity | 223 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 236.177630004 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 1 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 236.177630004 |
| Physical State | Liquid |
| Rotatable Bond Count | 3 |
| Topological Polar Surface Area | 29.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![2,2-Bis[[3-(dodecylthio)-1-oxopropoxy]methyl]propane-1,3-diyl bis[3-(dodecylthio)propionate]](https://resource.alfa-chemistry.com/structure/29598-76-3.gif)
