| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2516929-3 |
| Product Name | Bis(2,2,6,6-tetramethyl-1-piperidinyloxy-4-yl) sebacate |
| CAS | 2516-92-9 |
| Structure |  |
| Synonyms | Decanedioic acid bis(2,2,6,6-tetramethyl-4-piperidyl-1-oxyl) ester |
| Molecular Weight | 510.7 |
| Molecular Formula | C28H50N2O6 |
| Canonical SMILES | CC1(CC(CC(N1[O])(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(N(C(C2)(C)C)[O])(C)C)C |
| InChI | InChI=1S/C28H50N2O6/c1-25(2)17-21(18-26(3,4)29(25)33)35-23(31)15-13-11-9-10-12-14-16-24(32)36-22-19-27(5,6)30(34)28(7,8)20-22/h21-22H,9-20H2,1-8H3 |
| InChIKey | XVJWWMHPPKXKRU-UHFFFAOYSA-N |
| Melting Point | 99.0-103.0 °C |
| Purity | 98%+ |
| Appearance | Orange-red crystalline powder |
| Complexity | 650 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 510.36688732 |
| Formal Charge | 0 |
| Heavy Atom Count | 36 |
| Hydrogen Bond Acceptor Count | 6 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 510.36688732 |
| Physical State | Solid |
| Rotatable Bond Count | 13 |
| Topological Polar Surface Area | 61.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
