| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM3648213-1 |
| Product Name | Diheptyl phthalate |
| CAS | 3648-21-3 |
| Structure |  |
| Synonyms | Phthalic acid diheptyl ester |
| Molecular Weight | 362.50 |
| Molecular Formula | C6H4-1,2-[CO2(CH2)6CH3]2 |
| Canonical SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC |
| InChI | 1S/C22H34O4/c1-3-5-7-9-13-17-25-21(23)19-15-11-12-16-20(19)22(24)26-18-14-10-8-6-4-2/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | JQCXWCOOWVGKMT-UHFFFAOYSA-N |
| Boiling Point | 195 °C/0.04 mmHg (lit.) |
| Flash Point | 113 °C |
| Purity | 97% |
| Density | 0.988 g/mL at 25 °C (lit.) |
| Application | This product is suitable for scientific research. |
| Physical State | Colorless to yellow liquid |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
