| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM26636011-2 |
| Product Name | Diisooctyl 2,2'-[(dimethylstannylene)bis(thio)]diacetate |
| CAS | 26636-01-1 |
| Structure |  |
| Synonyms | Bis(isooctylthioglycolate)dimethyltin |
| IUPAC Name | 6-Methylheptyl 2-[dimethyl-[2-(6-methylheptoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate |
| Molecular Weight | 555.4 |
| Molecular Formula | C22H44O4S2Sn |
| Canonical SMILES | CC(C)CCCCCOC(=O)CS[Sn](C)(C)SCC(=O)OCCCCCC(C)C |
| InChI | InChI=1S/2C10H20O2S.2CH3.Sn/c2*1-9(2)6-4-3-5-7-12-10(11)8-13;/h2*9,13H,3-8H2,1-2H3;2*1H3;/q;+2/p-2 |
| InChIKey | IRFPIPNMASANJY-UHFFFAOYSA-L |
| Flash Point | 127 °C |
| Purity | 99% |
| Complexity | 405 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 556.170305 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Hydrogen Bond Acceptor Count | 6 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 556.170305 |
| Rotatable Bond Count | 20 |
| Topological Polar Surface Area | 103 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
