| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM1731799-1 |
| Product Name | Dimethyl 1,10-decanedicarboxylate |
| CAS | 1731-79-9 |
| Structure |  |
| Synonyms | Dodecanedioic acid dimethyl ester |
| IUPAC Name | Dimethyl dodecanedioate |
| Molecular Weight | 258.35 |
| Molecular Formula | C14H26O4 |
| Canonical SMILES | COC(=O)CCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| InChIKey | IZMOTZDBVPMOFE-UHFFFAOYSA-N |
| Boiling Point | 187-188 °C |
| Melting Point | 30-32 °C |
| Flash Point | 187-188 °C |
| Purity | 98%+ |
| Density | 0.9914 g/cm3 |
| Complexity | 202 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 258.18310931 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 258.18310931 |
| Physical State | Solid |
| Rotatable Bond Count | 13 |
| Topological Polar Surface Area | 52.6 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
