| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM93469-2 |
| Product Name | N,N'-Di-2-naphthyl-p-phenylenediamine |
| CAS | 93-46-9 |
| Structure |  |
| Synonyms | Antioxidant DNP |
| IUPAC Name | 1-N,4-N-dinaphthalen-2-ylbenzene-1,4-diamine |
| Molecular Weight | 360.4 |
| Molecular Formula | C26H20N2 |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)NC3=CC=C(C=C3)NC4=CC5=CC=CC=C5C=C4 |
| InChI | InChI=1S/C26H20N2/c1-3-7-21-17-25(11-9-19(21)5-1)27-23-13-15-24(16-14-23)28-26-12-10-20-6-2-4-8-22(20)18-26/h1-18,27-28H |
| InChIKey | VETPHHXZEJAYOB-UHFFFAOYSA-N |
| Boiling Point | 608.1 °C |
| Melting Point | 225-229 °C |
| Flash Point | 399ºC |
| Purity | 98% |
| Density | 1.25 g/cm3 |
| Appearance | Light grey white powder |
| Complexity | 439 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 360.162648646 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 360.162648646 |
| Physical State | White powder |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 24.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
