| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM92842-2 |
| Product Name | Phenothiazine |
| CAS | 92-84-2 |
| Structure |  |
| Synonyms | Dibenzo-1,4-thiazine |
| Description | The structure of phenothiazine is rigid, being tricyclic. It is known to alter dopamine (3,4-dihydroxyphenethylamine). Its use as an electron donor is based on its unique hole transporting ability, electron releasing nitrogen and sulfur heteroatoms and its non-planar structure leading to lower molecular aggregation. |
| IUPAC Name | 10H-Phenothiazine |
| Molecular Weight | 199.27 |
| Molecular Formula | C12H9NS |
| Canonical SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3S2 |
| InChI | InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | WJFKNYWRSNBZNX-UHFFFAOYSA-N |
| Boiling Point | 371 °C |
| Melting Point | 184 °C |
| Flash Point | 202 °C |
| Purity | 99.14% |
| Density | 1.34 g/cm3 |
| Solubility | less than 1 mg/mL at 68° F (NTP, 1992);7.98e-06 M;FREELY SOL IN BENZENE; SOL IN ETHER & IN HOT ACETIC ACID; SLIGHTLY SOL IN ALCOHOL & IN MINERAL OILS; PRACTICALLY INSOL IN PETROLEUM ETHER, CHLOROFORM;VERY SOL IN ACETONE;Water solubilty = 1.59 mg/l at 25 °C;Solubility in water: none;Insoluble |
| Appearance | Solid |
| Application | Phenothiazine finds uses in metal free organic dye sensitizers, dyes and antioxidants. |
| Storage | room temp |
| Autoignition Temperature | 471 °C |
| Complexity | 187 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 199.04557046 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 1 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 199.04557046 |
| Physical State | Yellow prills or beads |
| Rotatable Bond Count | 0 |
| Topological Polar Surface Area | 37.3 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Vapor Pressure | 0 mm Hg (approx) (NIOSH, 2016);0 mmHg (approx);0 mmHg (approx) |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
