| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM1587219-1 |
| Product Name | Tripropyl citrate |
| CAS | 1587-21-9 |
| Structure |  |
| Synonyms | Citric acid tri-N-propyl ester |
| IUPAC Name | Tripropyl 2-hydroxypropane-1,2,3-tricarboxylate |
| Molecular Weight | 318.36 |
| Molecular Formula | C15H26O7 |
| Canonical SMILES | CCCOC(=O)CC(CC(=O)OCCC)(C(=O)OCCC)O |
| InChI | InChI=1S/C15H26O7/c1-4-7-20-12(16)10-15(19,14(18)22-9-6-3)11-13(17)21-8-5-2/h19H,4-11H2,1-3H3 |
| InChIKey | ODHUFJLMXDXVRC-UHFFFAOYSA-N |
| Boiling Point | 198 °C |
| Flash Point | 109 °C |
| Purity | 97%+ |
| Density | 1.08 g/cm3 |
| Complexity | 343 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 318.16785316 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Hydrogen Bond Acceptor Count | 7 |
| Hydrogen Bond Donor Count | 1 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 318.16785316 |
| Physical State | Liquid |
| Rotatable Bond Count | 14 |
| Topological Polar Surface Area | 99.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
