| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM77623-1 |
| Product Name | 2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] |
| CAS | 77-62-3 |
| Structure |  |
| Synonyms | 2,2'-Methylenebis(6-(1-methylcyclohexyl)-p-cresol) |
| IUPAC Name | 2-[[2-Hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl]-4-methyl-6-(1-methylcyclohexyl)phenol |
| Molecular Weight | 420.6 |
| Molecular Formula | C29H40O2 |
| Canonical SMILES | CC1=CC(=C(C(=C1)C2(CCCCC2)C)O)CC3=C(C(=CC(=C3)C)C4(CCCCC4)C)O |
| InChI | InChI=1S/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
| InChIKey | PHXLONCQBNATSL-UHFFFAOYSA-N |
| Boiling Point | 526.9±50.0 °C |
| Melting Point | 135 °C |
| Purity | 95%+ |
| Density | 1.058±0.06 g/cm3 |
| Complexity | 523 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 420.302830514 |
| Formal Charge | 0 |
| Heavy Atom Count | 31 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 420.302830514 |
| Physical State | Solid |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 40.5 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![N,N'-Propane-1,3-diylbis[3-(3,5-dI-tert-butyl-4-hydroxyphenyl)propionamide]](https://resource.alfa-chemistry.com/structure/69851-61-2.gif)
