| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM69851612-1 |
| Product Name | N,N'-Propane-1,3-diylbis[3-(3,5-dI-tert-butyl-4-hydroxyphenyl)propionamide] |
| CAS | 69851-61-2 |
| Structure |  |
| Synonyms | N,N'-1,3-Propanediylbis(3,5-di-tert-butyl-4-hydroxyhydrocinnamamide) |
| IUPAC Name | 3-(3,5-Ditert-butyl-4-hydroxyphenyl)-N-[3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoylamino]propyl]propanamide |
| Molecular Weight | 594.9 |
| Molecular Formula | C37H58N2O4 |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)NCCCNC(=O)CCC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
| InChI | InChI=1S/C37H58N2O4/c1-34(2,3)26-20-24(21-27(32(26)42)35(4,5)6)14-16-30(40)38-18-13-19-39-31(41)17-15-25-22-28(36(7,8)9)33(43)29(23-25)37(10,11)12/h20-23,42-43H,13-19H2,1-12H3,(H,38,40)(H,39,41) |
| InChIKey | KJEKRODBOPOEGG-UHFFFAOYSA-N |
| Boiling Point | 711.0±60.0 °C |
| Purity | 95%+ |
| Density | 1.036±0.06 g/cm3 |
| Complexity | 768 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 594.43965834 |
| Formal Charge | 0 |
| Heavy Atom Count | 43 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 4 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 594.43965834 |
| Physical State | Solid |
| Rotatable Bond Count | 14 |
| Topological Polar Surface Area | 98.7 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
![2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol]](https://resource.alfa-chemistry.com/structure/77-62-3.gif)
