| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM10081671-1 |
| Product Name | 4,4'-Bis(α,α-dimethylbenzyl)diphenylamine |
| CAS | 10081-67-1 |
| Structure |  |
| Description | DryPowder; OtherSolid; PelletsLargeCrystals |
| IUPAC Name | 4-(2-phenylpropan-2-yl)-N-[4-(2-phenylpropan-2-yl)phenyl]aniline |
| Molecular Weight | 406 |
| Molecular Formula | C30H31N |
| Canonical SMILES | CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C(C)(C)C4=CC=CC=C4 |
| InChI | InChI=1S/C30H31N/c1-29(2,23-11-7-5-8-12-23)25-15-19-27(20-16-25)31-28-21-17-26(18-22-28)30(3,4)24-13-9-6-10-14-24/h5-22,31H,1-4H3 |
| InChIKey | UJAWGGOCYUPCPS-UHFFFAOYSA-N |
| Melting Point | ≥98.50 °C |
| Complexity | 473 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 405.24565g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 31 |
| Monoisotopic Mass | 405.24565g/mol |
| Physical State | White powder |
| Rotatable Bond Count | 6 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
