| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM80091-3 |
| Product Name | 4,4'-Sulfonyldiphenol |
| CAS | 80-09-1 |
| Structure |  |
| Synonyms | Bisphenol S, Bis(4-hydroxyphenyl) sulfone, 4-Hydroxyphenyl sulfone |
| Description | DryPowder; PelletsLargeCrystals |
| IUPAC Name | 4-(4-Hydroxyphenyl)sulfonylphenol |
| Molecular Weight | 250.27 |
| Molecular Formula | O2S(C6H4OH)2 |
| Canonical SMILES | Oc1ccc(cc1)S(=O)(=O)c2ccc(O)cc2 |
| InChI | 1S/C12H10O4S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | VPWNQTHUCYMVMZ-UHFFFAOYSA-N |
| Boiling Point | 363.4 °C |
| Melting Point | 245-250 °C (lit.) |
| Density | 1.366 g/cm3 |
| Solubility | Insoluble in water;Soluble in ethanol, ether; slightly soluble in benzene, DMSO |
| Application | This product is suitable for scientific research. |
| Complexity | 302 |
| Covalently-Bonded Unit Count | 1 |
| Decomposition | When heated to decomposition it emits toxic fumes of Sulfur oxides. |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 250.02997997 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 2 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 250.02997997 |
| Physical State | Solid |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 83 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Vapor Pressure | 4.7X10-10 mm Hg at 25 °C (est) |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
