| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2370185-2 |
| Product Name | Galvinoxyl free radical |
| CAS | 2370-18-5 |
| Structure |  |
| Synonyms | Galvinoxylradical |
| Molecular Weight | 421.6 |
| Molecular Formula | C29H41O2 |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1[O])C(C)(C)C)C=C2C=C(C(=O)C(=C2)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H41O2/c1-26(2,3)20-14-18(15-21(24(20)30)27(4,5)6)13-19-16-22(28(7,8)9)25(31)23(17-19)29(10,11)12/h13-17H,1-12H3 |
| InChIKey | GNZDAXRYGVFYPU-UHFFFAOYSA-N |
| Boiling Point | 478.49 °C |
| Melting Point | 158-159 °C |
| Density | 1.0321 g/cm3 |
| Appearance | Dark red to Dark purple to Dark blue powder to crystal |
| Storage | Store under inert gas |
| Complexity | 656 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 421.310655546 |
| Formal Charge | 0 |
| Heavy Atom Count | 31 |
| Hydrogen Bond Acceptor Count | 1 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 421.310655546 |
| Physical State | Solid |
| Rotatable Bond Count | 5 |
| Topological Polar Surface Area | 18.1 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
