| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM32289580-2 |
| Product Name | Poly (hexamethylene biguanide) hydrochloride |
| CAS | 32289-58-0 |
| Structure |  |
| Synonyms | Poly(hexamethylenediguanide) hydrochloride |
| IUPAC Name | N'-[6-[(N'-Methylcarbamimidoyl)amino]hexyl]ethanimidamide |
| Molecular Weight | 213.32 |
| Molecular Formula | C10H23N5 |
| Canonical SMILES | CC(=NCCCCCCNC(=NC)N)N |
| InChI | InChI=1S/C10H23N5/c1-9(11)14-7-5-3-4-6-8-15-10(12)13-2/h3-8H2,1-2H3,(H2,11,14)(H3,12,13,15) |
| InChIKey | SAGIGHPRUJPLKX-UHFFFAOYSA-N |
| Complexity | 210 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 213.19534575 |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 3 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 213.19534575 |
| Physical State | Colourless transparent liquid |
| Rotatable Bond Count | 8 |
| Topological Polar Surface Area | 88.8 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
