| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM2622084-2 |
| Product Name | Tri-o-tolyl phosphite |
| CAS | 2622-08-4 |
| Structure |  |
| Synonyms | Phosphorous acid tri-o-cresyl ester |
| IUPAC Name | Tris(2-methylphenyl) phosphite |
| Molecular Weight | 352.4 |
| Molecular Formula | C21H21O3P |
| Canonical SMILES | CC1=CC=CC=C1OP(OC2=CC=CC=C2C)OC3=CC=CC=C3C |
| InChI | InChI=1S/C21H21O3P/c1-16-10-4-7-13-19(16)22-25(23-20-14-8-5-11-17(20)2)24-21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
| InChIKey | BKHZQJRTFNFCTG-UHFFFAOYSA-N |
| Boiling Point | 200-202 °C |
| Melting Point | 11 °C |
| Flash Point | 200-202 °C |
| Purity | 97%+ |
| Density | 1.1423 g/mL |
| Complexity | 334 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 352.12283153 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Hydrogen Bond Acceptor Count | 3 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 352.12283153 |
| Physical State | Liquid |
| Rotatable Bond Count | 6 |
| Topological Polar Surface Area | 27.7 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
