| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM31570044-2 |
| Product Name | Tris(2,4-di-tert-butylphenyl) phosphite |
| CAS | 31570-04-4 |
| Structure |  |
| Synonyms | 2,4-Bis(1,1-dimethylethyl)phenol phosphite (3:1), Tri(2,4-di-t -butylphenyl) phosphite, Tri(2,4-di-tert -butylphenyl) phosphite |
| Description | Tris(2,4-di-tert-butylphenyl) phosphite is a triaryl based phosphite that can be used in catalysis and metallation. Its characteristic to undergo metallation reaction and provide a cost effective synthetic processes allows it to be useful in biaryl coupling reactions. |
| IUPAC Name | tris(2,4-ditert-butylphenyl) phosphite |
| Molecular Weight | 646.92 |
| Molecular Formula | [[(CH3)3C]2C6H3O]3P |
| Canonical SMILES | CC(C)(C)c1ccc(OP(Oc2ccc(cc2C(C)(C)C)C(C)(C)C)Oc3ccc(cc3C(C)(C)C)C(C)(C)C)c(c1)C(C)(C)C |
| InChI | 1S/C42H63O3P/c1-37(2,3)28-19-22-34(31(25-28)40(10,11)12)43-46(44-35-23-20-29(38(4,5)6)26-32(35)41(13,14)15)45-36-24-21-30(39(7,8)9)27-33(36)42(16,17)18/h19-27H,1-18H3 |
| InChIKey | JKIJEFPNVSHHEI-UHFFFAOYSA-N |
| Melting Point | 181-184 °C (lit.) |
| Purity | 99% |
| Application | It may be used as a chain extender and a processing stabilizer that facilitate the production of stable polymeric materials, which include polylactic acid (PLA), polyolefins, etc. |
| Complexity | 823 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 646.451483g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 46 |
| Monoisotopic Mass | 646.451483g/mol |
| Rotatable Bond Count | 12 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
