| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM118821-3 |
| Product Name | 4,4'-Methylenebis(2,6-di-tert-butylphenol) |
| CAS | 118-82-1 |
| Structure |  |
| Description | DryPowder; Liquid; OtherSolid, Liquid |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol |
| Molecular Weight | 424.66 |
| Molecular Formula | CH2[C6H2[C(CH3)3]2OH]2 |
| Canonical SMILES | CC(C)(C)c1cc(Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)cc(c1O)C(C)(C)C |
| InChI | 1S/C29H44O2/c1-26(2,3)20-14-18(15-21(24(20)30)27(4,5)6)13-19-16-22(28(7,8)9)25(31)23(17-19)29(10,11)12/h14-17,30-31H,13H2,1-12H3 |
| InChIKey | MDWVSAYEQPLWMX-UHFFFAOYSA-N |
| Boiling Point | 289 °C/40 mmHg (lit.) |
| Melting Point | 155-159 °C (lit.) |
| Purity | 99% |
| Application | Antioxidant. |
| Complexity | 480 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 424.334131g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 31 |
| Monoisotopic Mass | 424.334131g/mol |
| Physical State | White to off-white powder |
| Rotatable Bond Count | 6 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
