| Typical physical and chemical properties | |
|---|---|
| Catalog Number | ACM13463417-2 |
| Product Name | Zinc pyrithione |
| CAS | 13463-41-7 |
| Structure |  |
| Synonyms | ZPT |
| Description | Pyrithione zinc, also commonly known as zinc pyrithione, has antibacterial, antimicrobial, and antifungal properties that can help treat seborrheic dermatitis (also called dandruff), scalp psoriasis, and acne. |
| IUPAC Name | Zinc;1-oxidopyridin-1-ium-2-thiolate |
| Molecular Weight | 317.40 |
| Molecular Formula | C10H8N2O2S2Zn |
| Canonical SMILES | C1=CC=[N+](C(=C1)[S-])[O-].C1=CC=[N+](C(=C1)[S-])[O-].[Zn+2] |
| InChI | InChI=1S/2C5H5NOS.Zn/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,8H;/q;+2/p-2 |
| InChIKey | OTPSWLRZXRHDNX-UHFFFAOYSA-L |
| Melting Point | 240 ℃ |
| Purity | 98% |
| Density | 1.782 g/cm3 |
| Solubility | insoluble (<0.1 g/100 mL at 21 ºC) |
| Appearance | White to slight yellow powder or white suspension |
| Application | ZPT-50 is the most important antidandruf agent in the world, which used for more than 30 years in shampoo. ZPT-50 shows excellent inhibiting effect on pytyrosporum ovale that causes dandruff. ZPT has broad spectrum bactericide and marine antifouling material, and is well used for cosmetic, shampoo, skins medicine, adhesive and coating painting and so on. |
| Storage | Content is unchanged in two years. |
| Complexity | 183 |
| Covalently-Bonded Unit Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Exact Mass | 315.931862 |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| Hydrogen Bond Acceptor Count | 4 |
| Hydrogen Bond Donor Count | 0 |
| Isotope Atom Count | 0 |
| Monoisotopic Mass | 315.931862 |
| pH | 6.5-8.5 (5% solution) |
| Physical State | Off-white Powder |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 52.9 Ų |
| Undefined Atom Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| MSDS | Download MSDS |
| COA | Download COA |
| Spec Sheet | Download Spec Sheet |
※ Please kindly note that our products are for research use only.
